C27H29ClN4 — CID 70128637
N-[2-(4-chlorophenyl)ethyl]-9-(2,4-dimethylphenyl)-2-methyl-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine (PubChem CID 70128637) has the molecular formula C27H29ClN4 and a molecular weight of 445.01 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-9-(2,4-dimethylphenyl)-2-methyl-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-9-(2,4-dimethylphenyl)-2-methyl-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine |
|---|---|
| PubChem CID | 70128637 |
| Molecular Formula | C27H29ClN4 |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-9-(2,4-dimethylphenyl)-2-methyl-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine |
| SMILES | Cc1ccc(-n2c3c(c4c(NCCc5ccc(Cl)cc5)nc(C)nc42)CCCC3)c(C)c1 |
| InChI | InChI=1S/C27H29ClN4/c1-17-8-13-23(18(2)16-17)32-24-7-5-4-6-22(24)25-26(30-19(3)31-27(25)32)29-15-14-20-9-11-21(28)12-10-20/h8-13,16H,4-7,14-15H2,1-3H3,(H,29,30,31) |
| InChIKey | BUYQEEHUWOHZNW-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |