C20H15Cl2N3O4 — CID 70128751
[(4E)-5,7-dichloro-4-[2-(4-cyano-N-methylanilino)-2-oxoethylidene]-2,3-dihydro-1H-quinolin-2-yl] hydrogen carbonate (PubChem CID 70128751) has the molecular formula C20H15Cl2N3O4 and a molecular weight of 432.26 g/mol. Its IUPAC name is [(4E)-5,7-dichloro-4-[2-(4-cyano-N-methylanilino)-2-oxoethylidene]-2,3-dihydro-1H-quinolin-2-yl] hydrogen carbonate.
| Compound Name | [(4E)-5,7-dichloro-4-[2-(4-cyano-N-methylanilino)-2-oxoethylidene]-2,3-dihydro-1H-quinolin-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70128751 |
| Molecular Formula | C20H15Cl2N3O4 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | [(4E)-5,7-dichloro-4-[2-(4-cyano-N-methylanilino)-2-oxoethylidene]-2,3-dihydro-1H-quinolin-2-yl] hydrogen carbonate |
| SMILES | CN(C(=O)/C=C1\CC(OC(=O)O)Nc2cc(Cl)cc(Cl)c21)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H15Cl2N3O4/c1-25(14-4-2-11(10-23)3-5-14)18(26)7-12-6-17(29-20(27)28)24-16-9-13(21)8-15(22)19(12)16/h2-5,7-9,17,24H,6H2,1H3,(H,27,28)/b12-7+ |
| InChIKey | ZBDIYOLRVFJDEQ-KPKJPENVSA-N |
| XLogP | 4.75 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|