C22H23NO3 — CID 7012905
(3S)-3-[2-(4-cyclohexylphenyl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one (PubChem CID 7012905) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (3S)-3-[2-(4-cyclohexylphenyl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one.
| Compound Name | (3S)-3-[2-(4-cyclohexylphenyl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one |
|---|---|
| PubChem CID | 7012905 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (3S)-3-[2-(4-cyclohexylphenyl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one |
| SMILES | O=C(C[C@@]1(O)C(=O)Nc2ccccc21)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H23NO3/c24-20(14-22(26)18-8-4-5-9-19(18)23-21(22)25)17-12-10-16(11-13-17)15-6-2-1-3-7-15/h4-5,8-13,15,26H,1-3,6-7,14H2,(H,23,25)/t22-/m0/s1 |
| InChIKey | HNQXMVIOIUZZEU-QFIPXVFZSA-N |
| XLogP | 4.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |