C25H32N4O2 — CID 70129080
7-(1,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-ylmethylamino)-3-quinolin-3-ylheptanoic acid (PubChem CID 70129080) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 7-(1,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-ylmethylamino)-3-quinolin-3-ylheptanoic acid.
| Compound Name | 7-(1,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-ylmethylamino)-3-quinolin-3-ylheptanoic acid |
|---|---|
| PubChem CID | 70129080 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 7-(1,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-ylmethylamino)-3-quinolin-3-ylheptanoic acid |
| SMILES | O=C(O)CC(CCCCNCC1=CC=C2CCCNC2N1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C25H32N4O2/c30-24(31)15-19(21-14-20-7-1-2-9-23(20)28-16-21)6-3-4-12-26-17-22-11-10-18-8-5-13-27-25(18)29-22/h1-2,7,9-11,14,16,19,25-27,29H,3-6,8,12-13,15,17H2,(H,30,31) |
| InChIKey | MUHMQXREQOBCDC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|