About 4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one
4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one (PubChem CID 70129138) has the molecular formula C25H17N3O4S
and a molecular weight of 455.50 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one.
Molecular Properties
| Compound Name | 4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one |
| PubChem CID | 70129138 |
| Molecular Formula | C25H17N3O4S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(O)cc(O)c12.c1ccc2[nH]c(-c3cscn3)nc2c1 |
| InChI | InChI=1S/C15H10O4.C10H7N3S/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9;1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9/h1-8,16-17H;1-6H,(H,12,13) |
| InChIKey | JRXZURFEKNKLES-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one?
The IUPAC name of 4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one (CID 70129138) is 4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one.
What is the SMILES notation for 4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one?
The canonical SMILES for 4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one is O=c1cc(-c2ccccc2)oc2cc(O)cc(O)c12.c1ccc2[nH]c(-c3cscn3)nc2c1.
What is the InChIKey of 4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one?
The InChIKey is JRXZURFEKNKLES-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O4.C10H7N3S/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9;1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9/h1-8,16-17H;1-6H,(H,12,13).
What are the key properties of 4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one?
4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one has a molecular weight of 455.50 g/mol, XLogP of 5.56, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-benzimidazol-2-yl)-1,3-thiazole;5,7-dihydroxy-2-phenylchromen-4-one is sourced from PubChem (CID 70129138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).