C31H53NO3 — CID 70129165
8-[(5S,8S,9S,10S,11S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-yl]-N-methyl-N-propyloctanamide (PubChem CID 70129165) has the molecular formula C31H53NO3 and a molecular weight of 487.77 g/mol. Its IUPAC name is 8-[(5S,8S,9S,10S,11S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-yl]-N-methyl-N-propyloctanamide.
| Compound Name | 8-[(5S,8S,9S,10S,11S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-yl]-N-methyl-N-propyloctanamide |
|---|---|
| PubChem CID | 70129165 |
| Molecular Formula | C31H53NO3 |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 487.40 |
| IUPAC Name | 8-[(5S,8S,9S,10S,11S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-yl]-N-methyl-N-propyloctanamide |
| SMILES | CCCN(C)C(=O)CCCCCCC[C@H]1C[C@]2(C)[C@@H](O)CC[C@H]2[C@@H]2CC[C@H]3CC(=O)CC[C@]3(C)[C@@H]12 |
| InChI | InChI=1S/C31H53NO3/c1-5-19-32(4)28(35)12-10-8-6-7-9-11-22-21-31(3)26(15-16-27(31)34)25-14-13-23-20-24(33)17-18-30(23,2)29(22)25/h22-23,25-27,29,34H,5-21H2,1-4H3/t22-,23-,25-,26-,27-,29-,30-,31-/m0/s1 |
| InChIKey | XNNQLKFKZFQRIB-JHIDGQKESA-N |
| XLogP | 6.78 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|