About 2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine
2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 70129175) has the molecular formula C14H21NOS
and a molecular weight of 251.39 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| PubChem CID | 70129175 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | C=CCN1CCc2sc(OC(C)(C)C)cc2C1 |
| InChI | InChI=1S/C14H21NOS/c1-5-7-15-8-6-12-11(10-15)9-13(17-12)16-14(2,3)4/h5,9H,1,6-8,10H2,2-4H3 |
| InChIKey | PZVZPJHBDMNQJX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The IUPAC name of 2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine (CID 70129175) is 2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine.
What is the SMILES notation for 2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The canonical SMILES for 2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine is C=CCN1CCc2sc(OC(C)(C)C)cc2C1.
What is the InChIKey of 2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The InChIKey is PZVZPJHBDMNQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NOS/c1-5-7-15-8-6-12-11(10-15)9-13(17-12)16-14(2,3)4/h5,9H,1,6-8,10H2,2-4H3.
What are the key properties of 2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine?
2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine has a molecular weight of 251.39 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methylpropan-2-yl)oxy]-5-prop-2-enyl-6,7-dihydro-4H-thieno[3,2-c]pyridine is sourced from PubChem (CID 70129175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).