C5H9N3O3 — CID 70129755
(3-methyl-5-nitro-1,2-dihydroimidazol-2-yl)methanol (PubChem CID 70129755) has the molecular formula C5H9N3O3 and a molecular weight of 159.15 g/mol. Its IUPAC name is (3-methyl-5-nitro-1,2-dihydroimidazol-2-yl)methanol.
| Compound Name | (3-methyl-5-nitro-1,2-dihydroimidazol-2-yl)methanol |
|---|---|
| PubChem CID | 70129755 |
| Molecular Formula | C5H9N3O3 |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | (3-methyl-5-nitro-1,2-dihydroimidazol-2-yl)methanol |
| SMILES | CN1C=C([N+](=O)[O-])NC1CO |
| InChI | InChI=1S/C5H9N3O3/c1-7-2-4(8(10)11)6-5(7)3-9/h2,5-6,9H,3H2,1H3 |
| InChIKey | JEIKAUDIYIAQTE-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|