C28H32N4 — CID 70129926
2-methyl-N-[(2-methylphenyl)methyl]-9-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine (PubChem CID 70129926) has the molecular formula C28H32N4 and a molecular weight of 424.59 g/mol. Its IUPAC name is 2-methyl-N-[(2-methylphenyl)methyl]-9-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine.
| Compound Name | 2-methyl-N-[(2-methylphenyl)methyl]-9-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine |
|---|---|
| PubChem CID | 70129926 |
| Molecular Formula | C28H32N4 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 2-methyl-N-[(2-methylphenyl)methyl]-9-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine |
| SMILES | Cc1cc(C)c(-n2c3c(c4c(NCc5ccccc5C)nc(C)nc42)CCCC3)c(C)c1 |
| InChI | InChI=1S/C28H32N4/c1-17-14-19(3)26(20(4)15-17)32-24-13-9-8-12-23(24)25-27(30-21(5)31-28(25)32)29-16-22-11-7-6-10-18(22)2/h6-7,10-11,14-15H,8-9,12-13,16H2,1-5H3,(H,29,30,31) |
| InChIKey | IZRGQXAIHNLJHT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |