C12H18N4O6 — CID 70130147
3-(1-amino-3-methoxy-3-oxopropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylic acid (PubChem CID 70130147) has the molecular formula C12H18N4O6 and a molecular weight of 314.30 g/mol. Its IUPAC name is 3-(1-amino-3-methoxy-3-oxopropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylic acid.
| Compound Name | 3-(1-amino-3-methoxy-3-oxopropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 70130147 |
| Molecular Formula | C12H18N4O6 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-(1-amino-3-methoxy-3-oxopropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylic acid |
| SMILES | COC(=O)CC(N)N1C(=O)NC2(CCN(C(=O)O)CC2)C1=O |
| InChI | InChI=1S/C12H18N4O6/c1-22-8(17)6-7(13)16-9(18)12(14-10(16)19)2-4-15(5-3-12)11(20)21/h7H,2-6,13H2,1H3,(H,14,19)(H,20,21) |
| InChIKey | FREYSVHBTHHMCA-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|