C19H21FN2O6 — CID 70130404
3-O-methyl 5-O-propyl 4-(4-fluoro-3-nitrophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70130404) has the molecular formula C19H21FN2O6 and a molecular weight of 392.38 g/mol. Its IUPAC name is 3-O-methyl 5-O-propyl 4-(4-fluoro-3-nitrophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-propyl 4-(4-fluoro-3-nitrophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70130404 |
| Molecular Formula | C19H21FN2O6 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3-O-methyl 5-O-propyl 4-(4-fluoro-3-nitrophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21FN2O6/c1-5-8-28-19(24)16-11(3)21-10(2)15(18(23)27-4)17(16)12-6-7-13(20)14(9-12)22(25)26/h6-7,9,17,21H,5,8H2,1-4H3 |
| InChIKey | VEJHZAZKOKQQCT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|