About (1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one
(1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (PubChem CID 70130686) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is (1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
Molecular Properties
| Compound Name | (1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| PubChem CID | 70130686 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | (1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| SMILES | O=C1C(CO)=C[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C7H8O4/c8-2-4-1-5-3-10-7(11-5)6(4)9/h1,5,7-8H,2-3H2/t5-,7+/m0/s1 |
| InChIKey | NXSSXACEOSONRX-CAHLUQPWSA-N |
| XLogP | -0.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The IUPAC name of (1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (CID 70130686) is (1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
What is the SMILES notation for (1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The canonical SMILES for (1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is O=C1C(CO)=C[C@H]2CO[C@@H]1O2.
What is the InChIKey of (1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The InChIKey is NXSSXACEOSONRX-CAHLUQPWSA-N. The full InChI is InChI=1S/C7H8O4/c8-2-4-1-5-3-10-7(11-5)6(4)9/h1,5,7-8H,2-3H2/t5-,7+/m0/s1.
What are the key properties of (1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
(1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one has a molecular weight of 156.14 g/mol, XLogP of -0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is sourced from PubChem (CID 70130686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).