About (1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one
(1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (PubChem CID 70130768) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is (1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
Molecular Properties
| Compound Name | (1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| PubChem CID | 70130768 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| SMILES | CCC1=C[C@H]2CO[C@H](O2)C1=O |
| InChI | InChI=1S/C8H10O3/c1-2-5-3-6-4-10-8(11-6)7(5)9/h3,6,8H,2,4H2,1H3/t6-,8+/m0/s1 |
| InChIKey | NGGQIUNDWLCCNJ-POYBYMJQSA-N |
| XLogP | 0.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The IUPAC name of (1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (CID 70130768) is (1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
What is the SMILES notation for (1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The canonical SMILES for (1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is CCC1=C[C@H]2CO[C@H](O2)C1=O.
What is the InChIKey of (1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The InChIKey is NGGQIUNDWLCCNJ-POYBYMJQSA-N. The full InChI is InChI=1S/C8H10O3/c1-2-5-3-6-4-10-8(11-6)7(5)9/h3,6,8H,2,4H2,1H3/t6-,8+/m0/s1.
What are the key properties of (1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
(1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one has a molecular weight of 154.16 g/mol, XLogP of 0.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3-ethyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is sourced from PubChem (CID 70130768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).