About 1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate
1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate (PubChem CID 70130833) has the molecular formula C24H32N4O3
and a molecular weight of 424.55 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate |
| PubChem CID | 70130833 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate |
| SMILES | O=C(Nc1cnc2ccccc2c1)OC1CN2CCC1CC2.OC1CN2CCC1CC2 |
| InChI | InChI=1S/C17H19N3O2.C7H13NO/c21-17(22-16-11-20-7-5-12(16)6-8-20)19-14-9-13-3-1-2-4-15(13)18-10-14;9-7-5-8-3-1-6(7)2-4-8/h1-4,9-10,12,16H,5-8,11H2,(H,19,21);6-7,9H,1-5H2 |
| InChIKey | RHCNNBXSKGFZMC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate?
The IUPAC name of 1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate (CID 70130833) is 1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate.
What is the SMILES notation for 1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate?
The canonical SMILES for 1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate is O=C(Nc1cnc2ccccc2c1)OC1CN2CCC1CC2.OC1CN2CCC1CC2.
What is the InChIKey of 1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate?
The InChIKey is RHCNNBXSKGFZMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O2.C7H13NO/c21-17(22-16-11-20-7-5-12(16)6-8-20)19-14-9-13-3-1-2-4-15(13)18-10-14;9-7-5-8-3-1-6(7)2-4-8/h1-4,9-10,12,16H,5-8,11H2,(H,19,21);6-7,9H,1-5H2.
What are the key properties of 1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate?
1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate has a molecular weight of 424.55 g/mol, XLogP of 2.95, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octan-3-ol;1-azabicyclo[2.2.2]octan-3-yl N-quinolin-3-ylcarbamate is sourced from PubChem (CID 70130833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).