C30H38N4O4 — CID 70130915
4-[3-[7-cyclopentyloxy-4-(2-phenylethylamino)quinazolin-6-yl]oxypropyl]-6,6-dimethylmorpholin-2-one (PubChem CID 70130915) has the molecular formula C30H38N4O4 and a molecular weight of 518.66 g/mol. Its IUPAC name is 4-[3-[7-cyclopentyloxy-4-(2-phenylethylamino)quinazolin-6-yl]oxypropyl]-6,6-dimethylmorpholin-2-one.
| Compound Name | 4-[3-[7-cyclopentyloxy-4-(2-phenylethylamino)quinazolin-6-yl]oxypropyl]-6,6-dimethylmorpholin-2-one |
|---|---|
| PubChem CID | 70130915 |
| Molecular Formula | C30H38N4O4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 4-[3-[7-cyclopentyloxy-4-(2-phenylethylamino)quinazolin-6-yl]oxypropyl]-6,6-dimethylmorpholin-2-one |
| SMILES | CC1(C)CN(CCCOc2cc3c(NCCc4ccccc4)ncnc3cc2OC2CCCC2)CC(=O)O1 |
| InChI | InChI=1S/C30H38N4O4/c1-30(2)20-34(19-28(35)38-30)15-8-16-36-26-17-24-25(18-27(26)37-23-11-6-7-12-23)32-21-33-29(24)31-14-13-22-9-4-3-5-10-22/h3-5,9-10,17-18,21,23H,6-8,11-16,19-20H2,1-2H3,(H,31,32,33) |
| InChIKey | MHUOCLZBONJVEB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|