C5H12NO6P — CID 70131002
[[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]amino]phosphonous acid (PubChem CID 70131002) has the molecular formula C5H12NO6P and a molecular weight of 213.13 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]amino]phosphonous acid.
| Compound Name | [[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]amino]phosphonous acid |
|---|---|
| PubChem CID | 70131002 |
| Molecular Formula | C5H12NO6P |
| Molecular Weight | 213.13 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | [[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]amino]phosphonous acid |
| SMILES | O[C@@H]1[C@H](O)[C@H](O)CO[C@H]1NP(O)O |
| InChI | InChI=1S/C5H12NO6P/c7-2-1-12-5(6-13(10)11)4(9)3(2)8/h2-11H,1H2/t2-,3-,4-,5-/m1/s1 |
| InChIKey | JDLYYRZSNZQXJB-TXICZTDVSA-N |
| XLogP | -2.77 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.13 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|