About 4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid
4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid (PubChem CID 70131021) has the molecular formula C13H18N4O3
and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid |
| PubChem CID | 70131021 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid |
| SMILES | C/N=C(\NCCNC(C)=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H18N4O3/c1-9(18)15-7-8-16-13(14-2)17-11-5-3-10(4-6-11)12(19)20/h3-6H,7-8H2,1-2H3,(H,15,18)(H,19,20)(H2,14,16,17) |
| InChIKey | FPBZSPURQHQIOG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid?
The IUPAC name of 4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid (CID 70131021) is 4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid.
What is the SMILES notation for 4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid?
The canonical SMILES for 4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid is C/N=C(\NCCNC(C)=O)Nc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid?
The InChIKey is FPBZSPURQHQIOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O3/c1-9(18)15-7-8-16-13(14-2)17-11-5-3-10(4-6-11)12(19)20/h3-6H,7-8H2,1-2H3,(H,15,18)(H,19,20)(H2,14,16,17).
What are the key properties of 4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid?
4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid has a molecular weight of 278.31 g/mol, XLogP of 0.51, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[N-(2-acetamidoethyl)-N'-methylcarbamimidoyl]amino]benzoic acid is sourced from PubChem (CID 70131021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).