About methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate
methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate (PubChem CID 70131107) has the molecular formula C11H15N3O5
and a molecular weight of 269.26 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate |
| PubChem CID | 70131107 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)Cn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N3O5/c1-6-4-14(11(18)13-9(6)16)5-8(15)12-7(2)10(17)19-3/h4,7H,5H2,1-3H3,(H,12,15)(H,13,16,18)/t7-/m0/s1 |
| InChIKey | FUXAVDCPIMNPJG-ZETCQYMHSA-N |
| XLogP | -1.48 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate?
The IUPAC name of methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate (CID 70131107) is methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate.
What is the SMILES notation for methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate?
The canonical SMILES for methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate is COC(=O)[C@H](C)NC(=O)Cn1cc(C)c(=O)[nH]c1=O.
What is the InChIKey of methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate?
The InChIKey is FUXAVDCPIMNPJG-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H15N3O5/c1-6-4-14(11(18)13-9(6)16)5-8(15)12-7(2)10(17)19-3/h4,7H,5H2,1-3H3,(H,12,15)(H,13,16,18)/t7-/m0/s1.
What are the key properties of methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate?
methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate has a molecular weight of 269.26 g/mol, XLogP of -1.48, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate is sourced from PubChem (CID 70131107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).