About carbonic acid;2-(2-fluoroethenyl)-1,1-dimethylcyclopropane
carbonic acid;2-(2-fluoroethenyl)-1,1-dimethylcyclopropane (PubChem CID 70131151) has the molecular formula C8H13FO3
and a molecular weight of 176.19 g/mol. Its IUPAC name is carbonic acid;2-(2-fluoroethenyl)-1,1-dimethylcyclopropane.
Analyze carbonic acid;2-(2-fluoroethenyl)-1,1-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;2-(2-fluoroethenyl)-1,1-dimethylcyclopropane?
The IUPAC name of carbonic acid;2-(2-fluoroethenyl)-1,1-dimethylcyclopropane (CID 70131151) is carbonic acid;2-(2-fluoroethenyl)-1,1-dimethylcyclopropane.
What is the SMILES notation for carbonic acid;2-(2-fluoroethenyl)-1,1-dimethylcyclopropane?
The canonical SMILES for carbonic acid;2-(2-fluoroethenyl)-1,1-dimethylcyclopropane is CC1(C)CC1C=CF.O=C(O)O.
What is the InChIKey of carbonic acid;2-(2-fluoroethenyl)-1,1-dimethylcyclopropane?
The InChIKey is SJIUMTKPWCAVQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F.CH2O3/c1-7(2)5-6(7)3-4-8;2-1(3)4/h3-4,6H,5H2,1-2H3;(H2,2,3,4).
What are the key properties of carbonic acid;2-(2-fluoroethenyl)-1,1-dimethylcyclopropane?
carbonic acid;2-(2-fluoroethenyl)-1,1-dimethylcyclopropane has a molecular weight of 176.19 g/mol, XLogP of 2.74, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;2-(2-fluoroethenyl)-1,1-dimethylcyclopropane is sourced from PubChem (CID 70131151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).