About trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one
trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one (PubChem CID 70131185) has the molecular formula C19H20O3S
and a molecular weight of 328.43 g/mol. Its IUPAC name is trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one.
Molecular Properties
| Compound Name | trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one |
| PubChem CID | 70131185 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one |
| SMILES | CC1(C)C(=O)[C@@H](c2ccccc2)[C@@H]1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H20O3S/c1-19(2)17(14-9-11-15(12-10-14)23(3,21)22)16(18(19)20)13-7-5-4-6-8-13/h4-12,16-17H,1-3H3/t16-,17-/m0/s1 |
| InChIKey | MDKNBFHJQZNLSD-IRXDYDNUSA-N |
| XLogP | 3.57 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one?
The IUPAC name of trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one (CID 70131185) is trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one.
What is the SMILES notation for trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one?
The canonical SMILES for trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one is CC1(C)C(=O)[C@@H](c2ccccc2)[C@@H]1c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one?
The InChIKey is MDKNBFHJQZNLSD-IRXDYDNUSA-N. The full InChI is InChI=1S/C19H20O3S/c1-19(2)17(14-9-11-15(12-10-14)23(3,21)22)16(18(19)20)13-7-5-4-6-8-13/h4-12,16-17H,1-3H3/t16-,17-/m0/s1.
What are the key properties of trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one?
trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one has a molecular weight of 328.43 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3R,4R)-2,2-dimethyl-3-(4-methylsulfonylphenyl)-4-phenylcyclobutan-1-one is sourced from PubChem (CID 70131185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).