About (1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one
(1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (PubChem CID 70131219) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is (1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
Molecular Properties
| Compound Name | (1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| PubChem CID | 70131219 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| SMILES | COCC1=C[C@H]2CO[C@H](O2)C1=O |
| InChI | InChI=1S/C8H10O4/c1-10-3-5-2-6-4-11-8(12-6)7(5)9/h2,6,8H,3-4H2,1H3/t6-,8+/m0/s1 |
| InChIKey | HDWZBDAEAMWIOD-POYBYMJQSA-N |
| XLogP | -0.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The IUPAC name of (1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (CID 70131219) is (1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
What is the SMILES notation for (1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The canonical SMILES for (1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is COCC1=C[C@H]2CO[C@H](O2)C1=O.
What is the InChIKey of (1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The InChIKey is HDWZBDAEAMWIOD-POYBYMJQSA-N. The full InChI is InChI=1S/C8H10O4/c1-10-3-5-2-6-4-11-8(12-6)7(5)9/h2,6,8H,3-4H2,1H3/t6-,8+/m0/s1.
What are the key properties of (1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
(1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one has a molecular weight of 170.16 g/mol, XLogP of -0.12, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is sourced from PubChem (CID 70131219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).