About [1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate
[1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate (PubChem CID 70131336) has the molecular formula C20H15N3O6S
and a molecular weight of 425.42 g/mol. Its IUPAC name is [1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate.
Molecular Properties
| Compound Name | [1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate |
| PubChem CID | 70131336 |
| Molecular Formula | C20H15N3O6S |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | [1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate |
| SMILES | Nc1cccc(Nc2cc(OS(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C20H15N3O6S/c21-10-4-3-5-11(8-10)23-14-9-15(29-30(26,27)28)18(22)17-16(14)19(24)12-6-1-2-7-13(12)20(17)25/h1-9,23H,21-22H2,(H,26,27,28) |
| InChIKey | ZVTHZXJRJICSBL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 161.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate?
The IUPAC name of [1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate (CID 70131336) is [1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate.
What is the SMILES notation for [1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate?
The canonical SMILES for [1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate is Nc1cccc(Nc2cc(OS(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)c1.
What is the InChIKey of [1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate?
The InChIKey is ZVTHZXJRJICSBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O6S/c21-10-4-3-5-11(8-10)23-14-9-15(29-30(26,27)28)18(22)17-16(14)19(24)12-6-1-2-7-13(12)20(17)25/h1-9,23H,21-22H2,(H,26,27,28).
What are the key properties of [1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate?
[1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate has a molecular weight of 425.42 g/mol, XLogP of 2.55, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [1-amino-4-(3-aminoanilino)-9,10-dioxoanthracen-2-yl] hydrogen sulfate is sourced from PubChem (CID 70131336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).