About (3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate
(3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate (PubChem CID 70131429) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is (3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | (3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate |
| PubChem CID | 70131429 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC(CC)CC(CC)(CC)C1 |
| InChI | InChI=1S/C16H28O2/c1-6-13-9-14(18-15(17)12(4)5)11-16(7-2,8-3)10-13/h13-14H,4,6-11H2,1-3,5H3 |
| InChIKey | YUXUSPMTVLPHMQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate?
The IUPAC name of (3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate (CID 70131429) is (3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate.
What is the SMILES notation for (3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate?
The canonical SMILES for (3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate is C=C(C)C(=O)OC1CC(CC)CC(CC)(CC)C1.
What is the InChIKey of (3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate?
The InChIKey is YUXUSPMTVLPHMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2/c1-6-13-9-14(18-15(17)12(4)5)11-16(7-2,8-3)10-13/h13-14H,4,6-11H2,1-3,5H3.
What are the key properties of (3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate?
(3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate has a molecular weight of 252.40 g/mol, XLogP of 4.49, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3,5-triethylcyclohexyl) 2-methylprop-2-enoate is sourced from PubChem (CID 70131429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).