About tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate
tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate (PubChem CID 70131548) has the molecular formula C21H37N5O4
and a molecular weight of 423.56 g/mol. Its IUPAC name is tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate |
| PubChem CID | 70131548 |
| Molecular Formula | C21H37N5O4 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(CCN2CCNCC2=O)N2CCNCC2=O)CC1 |
| InChI | InChI=1S/C21H37N5O4/c1-21(2,3)30-20(29)25-9-4-16(5-10-25)17(26-13-8-23-15-19(26)28)6-11-24-12-7-22-14-18(24)27/h16-17,22-23H,4-15H2,1-3H3 |
| InChIKey | JGGKNLOQMZTITG-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate (CID 70131548) is tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(C(CCN2CCNCC2=O)N2CCNCC2=O)CC1.
What is the InChIKey of tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate?
The InChIKey is JGGKNLOQMZTITG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37N5O4/c1-21(2,3)30-20(29)25-9-4-16(5-10-25)17(26-13-8-23-15-19(26)28)6-11-24-12-7-22-14-18(24)27/h16-17,22-23H,4-15H2,1-3H3.
What are the key properties of tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate?
tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate has a molecular weight of 423.56 g/mol, XLogP of 0.26, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[1,3-bis(2-oxopiperazin-1-yl)propyl]piperidine-1-carboxylate is sourced from PubChem (CID 70131548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).