About diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid
diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid (PubChem CID 70132616) has the molecular formula C31H28N4O2
and a molecular weight of 488.59 g/mol. Its IUPAC name is diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid.
Molecular Properties
| Compound Name | diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid |
| PubChem CID | 70132616 |
| Molecular Formula | C31H28N4O2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid |
| SMILES | CNc1c(C(=O)O)nc(-c2ccccc2)nc1-c1ccccc1.NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15N3O2.C13H13N/c1-19-15-14(12-8-4-2-5-9-12)20-17(21-16(15)18(22)23)13-10-6-3-7-11-13;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h2-11,19H,1H3,(H,22,23);1-10,13H,14H2 |
| InChIKey | FVPOSOCVJMFGBY-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid?
The IUPAC name of diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid (CID 70132616) is diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid.
What is the SMILES notation for diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid?
The canonical SMILES for diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid is CNc1c(C(=O)O)nc(-c2ccccc2)nc1-c1ccccc1.NC(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid?
The InChIKey is FVPOSOCVJMFGBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O2.C13H13N/c1-19-15-14(12-8-4-2-5-9-12)20-17(21-16(15)18(22)23)13-10-6-3-7-11-13;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h2-11,19H,1H3,(H,22,23);1-10,13H,14H2.
What are the key properties of diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid?
diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid has a molecular weight of 488.59 g/mol, XLogP of 6.29, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanamine;5-(methylamino)-2,6-diphenylpyrimidine-4-carboxylic acid is sourced from PubChem (CID 70132616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).