C25H36N4O3 — CID 70132629
6-[(8S,11S,13S,14S)-3-(diaminomethylidenehydrazinylidene)-13-methyl-17-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]hexanoic acid (PubChem CID 70132629) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is 6-[(8S,11S,13S,14S)-3-(diaminomethylidenehydrazinylidene)-13-methyl-17-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]hexanoic acid.
| Compound Name | 6-[(8S,11S,13S,14S)-3-(diaminomethylidenehydrazinylidene)-13-methyl-17-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]hexanoic acid |
|---|---|
| PubChem CID | 70132629 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 6-[(8S,11S,13S,14S)-3-(diaminomethylidenehydrazinylidene)-13-methyl-17-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]hexanoic acid |
| SMILES | C[C@]12C[C@H](CCCCCC(=O)O)C3=C4CCC(=NN=C(N)N)C=C4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C25H36N4O3/c1-25-14-16(5-3-2-4-6-22(31)32)23-18-10-8-17(28-29-24(26)27)13-15(18)7-9-19(23)20(25)11-12-21(25)30/h13,16,19-20H,2-12,14H2,1H3,(H,31,32)(H4,26,27,29)/t16-,19-,20-,25-/m0/s1 |
| InChIKey | FOQZAILOYGLLOE-ZCGKIOINSA-N |
| XLogP | 4.08 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|