C12H13NO3 — CID 7013279
5',7'-dimethylspiro[1,3-dioxolane-2,3'-1H-indole]-2'-one (PubChem CID 7013279) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 5',7'-dimethylspiro[1,3-dioxolane-2,3'-1H-indole]-2'-one.
| Compound Name | 5',7'-dimethylspiro[1,3-dioxolane-2,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 7013279 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 5',7'-dimethylspiro[1,3-dioxolane-2,3'-1H-indole]-2'-one |
| SMILES | Cc1cc(C)c2c(c1)C1(OCCO1)C(=O)N2 |
| InChI | InChI=1S/C12H13NO3/c1-7-5-8(2)10-9(6-7)12(11(14)13-10)15-3-4-16-12/h5-6H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | VANJIOPPVQCRCN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |