About 2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide
2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide (PubChem CID 70133022) has the molecular formula C10H16N4O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide |
| PubChem CID | 70133022 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide |
| SMILES | CNC(=O)n1cc(C(N)=O)nc1C(C)(C)C |
| InChI | InChI=1S/C10H16N4O2/c1-10(2,3)8-13-6(7(11)15)5-14(8)9(16)12-4/h5H,1-4H3,(H2,11,15)(H,12,16) |
| InChIKey | CKRBAFTXHNQLMQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide?
The IUPAC name of 2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide (CID 70133022) is 2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide.
What is the SMILES notation for 2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide?
The canonical SMILES for 2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide is CNC(=O)n1cc(C(N)=O)nc1C(C)(C)C.
What is the InChIKey of 2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide?
The InChIKey is CKRBAFTXHNQLMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O2/c1-10(2,3)8-13-6(7(11)15)5-14(8)9(16)12-4/h5H,1-4H3,(H2,11,15)(H,12,16).
What are the key properties of 2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide?
2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide has a molecular weight of 224.26 g/mol, XLogP of 0.47, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1-N-methylimidazole-1,4-dicarboxamide is sourced from PubChem (CID 70133022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).