About 2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione
2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione (PubChem CID 70133064) has the molecular formula C17H12Cl2N2O2
and a molecular weight of 347.20 g/mol. Its IUPAC name is 2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione.
Molecular Properties
| Compound Name | 2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione |
| PubChem CID | 70133064 |
| Molecular Formula | C17H12Cl2N2O2 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione |
| SMILES | O=C1NC(=O)C(Cc2ccccc2)N=C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl2N2O2/c18-12-7-6-11(9-13(12)19)15-17(23)21-16(22)14(20-15)8-10-4-2-1-3-5-10/h1-7,9,14H,8H2,(H,21,22,23) |
| InChIKey | ZJJHJJSBHWHLJY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione?
The IUPAC name of 2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione (CID 70133064) is 2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione.
What is the SMILES notation for 2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione?
The canonical SMILES for 2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione is O=C1NC(=O)C(Cc2ccccc2)N=C1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione?
The InChIKey is ZJJHJJSBHWHLJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2N2O2/c18-12-7-6-11(9-13(12)19)15-17(23)21-16(22)14(20-15)8-10-4-2-1-3-5-10/h1-7,9,14H,8H2,(H,21,22,23).
What are the key properties of 2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione?
2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione has a molecular weight of 347.20 g/mol, XLogP of 3.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-6-(3,4-dichlorophenyl)-2H-pyrazine-3,5-dione is sourced from PubChem (CID 70133064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).