C20H20F2O2 — CID 70133181
4-benzyl-1-(2,3-difluorophenyl)cyclohexane-1-carboxylic acid (PubChem CID 70133181) has the molecular formula C20H20F2O2 and a molecular weight of 330.37 g/mol. Its IUPAC name is 4-benzyl-1-(2,3-difluorophenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-benzyl-1-(2,3-difluorophenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 70133181 |
| Molecular Formula | C20H20F2O2 |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 4-benzyl-1-(2,3-difluorophenyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cccc(F)c2F)CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H20F2O2/c21-17-8-4-7-16(18(17)22)20(19(23)24)11-9-15(10-12-20)13-14-5-2-1-3-6-14/h1-8,15H,9-13H2,(H,23,24) |
| InChIKey | FBOGOWCGVGDQNF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |