C30H49FO3Si — CID 70133231
2-[(8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-7-propyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroacetic acid (PubChem CID 70133231) has the molecular formula C30H49FO3Si and a molecular weight of 504.80 g/mol. Its IUPAC name is 2-[(8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-7-propyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroacetic acid.
| Compound Name | 2-[(8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-7-propyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroacetic acid |
|---|---|
| PubChem CID | 70133231 |
| Molecular Formula | C30H49FO3Si |
| Molecular Weight | 504.80 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | 2-[(8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-7-propyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroacetic acid |
| SMILES | CCCC1C=C2CC(O[Si](C)(C)C(C)(C)C)CC[C@]2(C)[C@H]2CC[C@]3(C)C(=C(F)C(=O)O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C30H49FO3Si/c1-9-10-19-17-20-18-21(34-35(7,8)28(2,3)4)13-15-29(20,5)23-14-16-30(6)22(25(19)23)11-12-24(30)26(31)27(32)33/h17,19,21-23,25H,9-16,18H2,1-8H3,(H,32,33)/t19?,21?,22-,23-,25-,29-,30-/m0/s1 |
| InChIKey | KTSOOOJTUXRWRL-QWGYWUDRSA-N |
| XLogP | 8.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.80 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|