C26H43FO2Si — CID 70133232
2-[(3S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]-2-fluoroethanol (PubChem CID 70133232) has the molecular formula C26H43FO2Si and a molecular weight of 434.71 g/mol. Its IUPAC name is 2-[(3S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]-2-fluoroethanol.
| Compound Name | 2-[(3S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]-2-fluoroethanol |
|---|---|
| PubChem CID | 70133232 |
| Molecular Formula | C26H43FO2Si |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 2-[(3S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]-2-fluoroethanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(=C(F)CO)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H43FO2Si/c1-25(2,3)30(5,6)29-18-8-10-19-17(15-18)7-9-21-20(19)13-14-26(4)22(21)11-12-23(26)24(27)16-28/h7,18-22,28H,8-16H2,1-6H3/t18-,19-,20+,21+,22-,26-/m0/s1 |
| InChIKey | LXAGSSZUKIEPHG-PKLLIKTFSA-N |
| XLogP | 7.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|