C20H10O4 — CID 70133265
18-hydroxy-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),15,17,20-nonaene-3,10-dione (PubChem CID 70133265) has the molecular formula C20H10O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is 18-hydroxy-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),15,17,20-nonaene-3,10-dione.
| Compound Name | 18-hydroxy-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),15,17,20-nonaene-3,10-dione |
|---|---|
| PubChem CID | 70133265 |
| Molecular Formula | C20H10O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 18-hydroxy-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),15,17,20-nonaene-3,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1oc1c2ccc2c(O)cccc21 |
| InChI | InChI=1S/C20H10O4/c21-15-7-3-6-13-10(15)8-9-14-16-17(22)11-4-1-2-5-12(11)18(23)20(16)24-19(13)14/h1-9,21H |
| InChIKey | GSXRSSONKAJDDU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|