C28H47FO2Si — CID 70133367
2-[(7S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-7,10,13-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroethanol (PubChem CID 70133367) has the molecular formula C28H47FO2Si and a molecular weight of 462.77 g/mol. Its IUPAC name is 2-[(7S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-7,10,13-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroethanol.
| Compound Name | 2-[(7S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-7,10,13-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroethanol |
|---|---|
| PubChem CID | 70133367 |
| Molecular Formula | C28H47FO2Si |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | 2-[(7S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-7,10,13-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroethanol |
| SMILES | C[C@@H]1C=C2CC(O[Si](C)(C)C(C)(C)C)CC[C@]2(C)[C@H]2CC[C@]3(C)C(=C(F)CO)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C28H47FO2Si/c1-18-15-19-16-20(31-32(7,8)26(2,3)4)11-13-27(19,5)23-12-14-28(6)21(24(29)17-30)9-10-22(28)25(18)23/h15,18,20,22-23,25,30H,9-14,16-17H2,1-8H3/t18-,20?,22+,23+,25+,27+,28-/m1/s1 |
| InChIKey | SGRSHHNPSXXAHO-LURJZAPYSA-N |
| XLogP | 7.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|