C14H10FNO2 — CID 70133656
6-fluoro-3-(3-methoxyphenyl)-2,1-benzoxazole (PubChem CID 70133656) has the molecular formula C14H10FNO2 and a molecular weight of 243.24 g/mol. Its IUPAC name is 6-fluoro-3-(3-methoxyphenyl)-2,1-benzoxazole.
| Compound Name | 6-fluoro-3-(3-methoxyphenyl)-2,1-benzoxazole |
|---|---|
| PubChem CID | 70133656 |
| Molecular Formula | C14H10FNO2 |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 6-fluoro-3-(3-methoxyphenyl)-2,1-benzoxazole |
| SMILES | COc1cccc(-c2onc3cc(F)ccc23)c1 |
| InChI | InChI=1S/C14H10FNO2/c1-17-11-4-2-3-9(7-11)14-12-6-5-10(15)8-13(12)16-18-14/h2-8H,1H3 |
| InChIKey | SJTWVNLGRYTTCT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |