About 1-azabicyclo[2.2.2]octane;1-methylpyrrolidine
1-azabicyclo[2.2.2]octane;1-methylpyrrolidine (PubChem CID 70134138) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octane;1-methylpyrrolidine.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octane;1-methylpyrrolidine |
| PubChem CID | 70134138 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-azabicyclo[2.2.2]octane;1-methylpyrrolidine |
| SMILES | C1CN2CCC1CC2.CN1CCCC1 |
| InChI | InChI=1S/C7H13N.C5H11N/c1-4-8-5-2-7(1)3-6-8;1-6-4-2-3-5-6/h7H,1-6H2;2-5H2,1H3 |
| InChIKey | DPHXJPBJXGFQHI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-azabicyclo[2.2.2]octane;1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octane;1-methylpyrrolidine?
The IUPAC name of 1-azabicyclo[2.2.2]octane;1-methylpyrrolidine (CID 70134138) is 1-azabicyclo[2.2.2]octane;1-methylpyrrolidine.
What is the SMILES notation for 1-azabicyclo[2.2.2]octane;1-methylpyrrolidine?
The canonical SMILES for 1-azabicyclo[2.2.2]octane;1-methylpyrrolidine is C1CN2CCC1CC2.CN1CCCC1.
What is the InChIKey of 1-azabicyclo[2.2.2]octane;1-methylpyrrolidine?
The InChIKey is DPHXJPBJXGFQHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C5H11N/c1-4-8-5-2-7(1)3-6-8;1-6-4-2-3-5-6/h7H,1-6H2;2-5H2,1H3.
What are the key properties of 1-azabicyclo[2.2.2]octane;1-methylpyrrolidine?
1-azabicyclo[2.2.2]octane;1-methylpyrrolidine has a molecular weight of 196.34 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octane;1-methylpyrrolidine is sourced from PubChem (CID 70134138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).