About 2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one
2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one (PubChem CID 70134790) has the molecular formula C14H13ClN4OS
and a molecular weight of 320.81 g/mol. Its IUPAC name is 2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one.
Molecular Properties
| Compound Name | 2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one |
| PubChem CID | 70134790 |
| Molecular Formula | C14H13ClN4OS |
| Molecular Weight | 320.81 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one |
| SMILES | CN1C(=O)C(C)(c2cc(-c3cncc(Cl)c3)cs2)N=C1N |
| InChI | InChI=1S/C14H13ClN4OS/c1-14(12(20)19(2)13(16)18-14)11-4-9(7-21-11)8-3-10(15)6-17-5-8/h3-7H,1-2H3,(H2,16,18) |
| InChIKey | UHVFYLMZIZJECK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.81 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one?
The IUPAC name of 2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one (CID 70134790) is 2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one.
What is the SMILES notation for 2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one?
The canonical SMILES for 2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one is CN1C(=O)C(C)(c2cc(-c3cncc(Cl)c3)cs2)N=C1N.
What is the InChIKey of 2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one?
The InChIKey is UHVFYLMZIZJECK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN4OS/c1-14(12(20)19(2)13(16)18-14)11-4-9(7-21-11)8-3-10(15)6-17-5-8/h3-7H,1-2H3,(H2,16,18).
What are the key properties of 2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one?
2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one has a molecular weight of 320.81 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[4-(5-chloro-3-pyridinyl)thiophen-2-yl]-3,5-dimethylimidazol-4-one is sourced from PubChem (CID 70134790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).