C25H37Cl2N7O3S — CID 70134939
5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;2-N-tert-butyl-4-N-ethyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine (PubChem CID 70134939) has the molecular formula C25H37Cl2N7O3S and a molecular weight of 586.59 g/mol. Its IUPAC name is 5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;2-N-tert-butyl-4-N-ethyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;2-N-tert-butyl-4-N-ethyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 70134939 |
| Molecular Formula | C25H37Cl2N7O3S |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | 5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;2-N-tert-butyl-4-N-ethyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)Oc1cc(-n2nc(C(C)(C)C)oc2=O)c(Cl)cc1Cl.CCNc1nc(NC(C)(C)C)nc(SC)n1 |
| InChI | InChI=1S/C15H18Cl2N2O3.C10H19N5S/c1-8(2)21-12-7-11(9(16)6-10(12)17)19-14(20)22-13(18-19)15(3,4)5;1-6-11-7-12-8(15-10(2,3)4)14-9(13-7)16-5/h6-8H,1-5H3;6H2,1-5H3,(H2,11,12,13,14,15) |
| InChIKey | DEPGROXAAGGRLB-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |