C40H34N2O4S — CID 70135130
1-cyclopropyl-8-methoxy-4-oxo-7-(6-trityl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)quinoline-3-carboxylic acid (PubChem CID 70135130) has the molecular formula C40H34N2O4S and a molecular weight of 638.79 g/mol. Its IUPAC name is 1-cyclopropyl-8-methoxy-4-oxo-7-(6-trityl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)quinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-8-methoxy-4-oxo-7-(6-trityl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 70135130 |
| Molecular Formula | C40H34N2O4S |
| Molecular Weight | 638.79 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | 1-cyclopropyl-8-methoxy-4-oxo-7-(6-trityl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)quinoline-3-carboxylic acid |
| SMILES | COc1c(-c2cc3c(s2)CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC3)ccc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C40H34N2O4S/c1-46-38-31(19-20-32-36(38)42(30-17-18-30)24-33(37(32)43)39(44)45)34-23-26-21-22-41(25-35(26)47-34)40(27-11-5-2-6-12-27,28-13-7-3-8-14-28)29-15-9-4-10-16-29/h2-16,19-20,23-24,30H,17-18,21-22,25H2,1H3,(H,44,45) |
| InChIKey | XJFSWOSMLSFURB-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.79 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|