C28H36Cl4N3O10P — CID 70135444
2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;3,6-dichloro-2-methoxybenzoic acid (PubChem CID 70135444) has the molecular formula C28H36Cl4N3O10P and a molecular weight of 747.39 g/mol. Its IUPAC name is 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;3,6-dichloro-2-methoxybenzoic acid.
| Compound Name | 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;3,6-dichloro-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 70135444 |
| Molecular Formula | C28H36Cl4N3O10P |
| Molecular Weight | 747.39 g/mol |
| Exact Mass | 745.09 |
| IUPAC Name | 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;3,6-dichloro-2-methoxybenzoic acid |
| SMILES | CC(C)Oc1cc(-n2nc(C(C)(C)C)oc2=O)c(Cl)cc1Cl.COc1c(Cl)ccc(Cl)c1C(=O)O.CP(=O)(O)CCC(N)C(=O)O |
| InChI | InChI=1S/C15H18Cl2N2O3.C8H6Cl2O3.C5H12NO4P/c1-8(2)21-12-7-11(9(16)6-10(12)17)19-14(20)22-13(18-19)15(3,4)5;1-13-7-5(10)3-2-4(9)6(7)8(11)12;1-11(9,10)3-2-4(6)5(7)8/h6-8H,1-5H3;2-3H,1H3,(H,11,12);4H,2-3,6H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | KPFMSZROSYHNCM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 204.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.39 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|