C21H20Cl2F2N8O4S — CID 70135522
4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one;N-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide (PubChem CID 70135522) has the molecular formula C21H20Cl2F2N8O4S and a molecular weight of 589.41 g/mol. Its IUPAC name is 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one;N-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide.
| Compound Name | 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one;N-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70135522 |
| Molecular Formula | C21H20Cl2F2N8O4S |
| Molecular Weight | 589.41 g/mol |
| Exact Mass | 588.07 |
| IUPAC Name | 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one;N-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide |
| SMILES | Cc1nn(-c2cc(NS(C)(=O)=O)c(Cl)cc2Cl)c(=O)n1C(F)F.Cc1nnc(-c2ccccc2)c(=O)n1N |
| InChI | InChI=1S/C11H10Cl2F2N4O3S.C10H10N4O/c1-5-16-19(11(20)18(5)10(14)15)9-4-8(17-23(2,21)22)6(12)3-7(9)13;1-7-12-13-9(10(15)14(7)11)8-5-3-2-4-6-8/h3-4,10,17H,1-2H3;2-6H,11H2,1H3 |
| InChIKey | IJQWSBVEJPIEIJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 159.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |