C28H45Cl2N8O8PS — CID 70135812
5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;2-N-tert-butyl-4-N-ethyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine;2-(phosphonomethylamino)acetic acid (PubChem CID 70135812) has the molecular formula C28H45Cl2N8O8PS and a molecular weight of 755.66 g/mol. Its IUPAC name is 5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;2-N-tert-butyl-4-N-ethyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine;2-(phosphonomethylamino)acetic acid.
| Compound Name | 5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;2-N-tert-butyl-4-N-ethyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine;2-(phosphonomethylamino)acetic acid |
|---|---|
| PubChem CID | 70135812 |
| Molecular Formula | C28H45Cl2N8O8PS |
| Molecular Weight | 755.66 g/mol |
| Exact Mass | 754.22 |
| IUPAC Name | 5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;2-N-tert-butyl-4-N-ethyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine;2-(phosphonomethylamino)acetic acid |
| SMILES | CC(C)Oc1cc(-n2nc(C(C)(C)C)oc2=O)c(Cl)cc1Cl.CCNc1nc(NC(C)(C)C)nc(SC)n1.O=C(O)CNCP(=O)(O)O |
| InChI | InChI=1S/C15H18Cl2N2O3.C10H19N5S.C3H8NO5P/c1-8(2)21-12-7-11(9(16)6-10(12)17)19-14(20)22-13(18-19)15(3,4)5;1-6-11-7-12-8(15-10(2,3)4)14-9(13-7)16-5;5-3(6)1-4-2-10(7,8)9/h6-8H,1-5H3;6H2,1-5H3,(H2,11,12,13,14,15);4H,1-2H2,(H,5,6)(H2,7,8,9) |
| InChIKey | HFYFZQCTVBVQMG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 226.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|