C29H37ClFN5O6 — CID 70136315
3-(4-chloro-5-cyclopentyloxy-2-fluorophenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione;3-cyclohexyl-6-(dimethylamino)-1-methyl-1,3,5-triazine-2,4-dione (PubChem CID 70136315) has the molecular formula C29H37ClFN5O6 and a molecular weight of 606.10 g/mol. Its IUPAC name is 3-(4-chloro-5-cyclopentyloxy-2-fluorophenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione;3-cyclohexyl-6-(dimethylamino)-1-methyl-1,3,5-triazine-2,4-dione.
| Compound Name | 3-(4-chloro-5-cyclopentyloxy-2-fluorophenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione;3-cyclohexyl-6-(dimethylamino)-1-methyl-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 70136315 |
| Molecular Formula | C29H37ClFN5O6 |
| Molecular Weight | 606.10 g/mol |
| Exact Mass | 605.24 |
| IUPAC Name | 3-(4-chloro-5-cyclopentyloxy-2-fluorophenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione;3-cyclohexyl-6-(dimethylamino)-1-methyl-1,3,5-triazine-2,4-dione |
| SMILES | CC(C)=C1OC(=O)N(c2cc(OC3CCCC3)c(Cl)cc2F)C1=O.CN(C)c1nc(=O)n(C2CCCCC2)c(=O)n1C |
| InChI | InChI=1S/C17H17ClFNO4.C12H20N4O2/c1-9(2)15-16(21)20(17(22)24-15)13-8-14(11(18)7-12(13)19)23-10-5-3-4-6-10;1-14(2)10-13-11(17)16(12(18)15(10)3)9-7-5-4-6-8-9/h7-8,10H,3-6H2,1-2H3;9H,4-8H2,1-3H3 |
| InChIKey | BRRFAEQYADJKNA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 115.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.10 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|