C25H28Cl2F3N5O3 — CID 70136830
N-benzyl-2,2-dimethyl-N-propan-2-ylpropanamide;1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-amine (PubChem CID 70136830) has the molecular formula C25H28Cl2F3N5O3 and a molecular weight of 574.43 g/mol. Its IUPAC name is N-benzyl-2,2-dimethyl-N-propan-2-ylpropanamide;1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-amine.
| Compound Name | N-benzyl-2,2-dimethyl-N-propan-2-ylpropanamide;1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 70136830 |
| Molecular Formula | C25H28Cl2F3N5O3 |
| Molecular Weight | 574.43 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | N-benzyl-2,2-dimethyl-N-propan-2-ylpropanamide;1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-amine |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)C(C)(C)C.Nc1c([N+](=O)[O-])cnn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H23NO.C10H5Cl2F3N4O2/c1-12(2)16(14(17)15(3,4)5)11-13-9-7-6-8-10-13;11-5-1-4(10(13,14)15)2-6(12)8(5)18-9(16)7(3-17-18)19(20)21/h6-10,12H,11H2,1-5H3;1-3H,16H2 |
| InChIKey | AIFVTIJAFADAKU-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.43 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|