About 4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one
4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one (PubChem CID 70137222) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one |
| PubChem CID | 70137222 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one |
| SMILES | CCCCCNC1=CC(=O)C=CC1C |
| InChI | InChI=1S/C12H19NO/c1-3-4-5-8-13-12-9-11(14)7-6-10(12)2/h6-7,9-10,13H,3-5,8H2,1-2H3 |
| InChIKey | MCUOQLJZCGEZRI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one?
The IUPAC name of 4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one (CID 70137222) is 4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one is CCCCCNC1=CC(=O)C=CC1C.
What is the InChIKey of 4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one?
The InChIKey is MCUOQLJZCGEZRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-3-4-5-8-13-12-9-11(14)7-6-10(12)2/h6-7,9-10,13H,3-5,8H2,1-2H3.
What are the key properties of 4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one?
4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one has a molecular weight of 193.29 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(pentylamino)cyclohexa-2,5-dien-1-one is sourced from PubChem (CID 70137222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).