C20H15Cl2F3N8O3 — CID 70137457
4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one;1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-amine (PubChem CID 70137457) has the molecular formula C20H15Cl2F3N8O3 and a molecular weight of 543.29 g/mol. Its IUPAC name is 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one;1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-amine.
| Compound Name | 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one;1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 70137457 |
| Molecular Formula | C20H15Cl2F3N8O3 |
| Molecular Weight | 543.29 g/mol |
| Exact Mass | 542.06 |
| IUPAC Name | 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one;1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-amine |
| SMILES | Cc1nnc(-c2ccccc2)c(=O)n1N.Nc1c([N+](=O)[O-])cnn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H5Cl2F3N4O2.C10H10N4O/c11-5-1-4(10(13,14)15)2-6(12)8(5)18-9(16)7(3-17-18)19(20)21;1-7-12-13-9(10(15)14(7)11)8-5-3-2-4-6-8/h1-3H,16H2;2-6H,11H2,1H3 |
| InChIKey | CZHMWUUDNAGQJL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|