C28H44Cl2N7O8PS — CID 70138125
4-amino-6-tert-butyl-3-methylsulfanyl-1,2,4-triazin-5-one;2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one (PubChem CID 70138125) has the molecular formula C28H44Cl2N7O8PS and a molecular weight of 740.65 g/mol. Its IUPAC name is 4-amino-6-tert-butyl-3-methylsulfanyl-1,2,4-triazin-5-one;2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one.
| Compound Name | 4-amino-6-tert-butyl-3-methylsulfanyl-1,2,4-triazin-5-one;2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 70138125 |
| Molecular Formula | C28H44Cl2N7O8PS |
| Molecular Weight | 740.65 g/mol |
| Exact Mass | 739.21 |
| IUPAC Name | 4-amino-6-tert-butyl-3-methylsulfanyl-1,2,4-triazin-5-one;2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one |
| SMILES | CC(C)Oc1cc(-n2nc(C(C)(C)C)oc2=O)c(Cl)cc1Cl.CP(=O)(O)CCC(N)C(=O)O.CSc1nnc(C(C)(C)C)c(=O)n1N |
| InChI | InChI=1S/C15H18Cl2N2O3.C8H14N4OS.C5H12NO4P/c1-8(2)21-12-7-11(9(16)6-10(12)17)19-14(20)22-13(18-19)15(3,4)5;1-8(2,3)5-6(13)12(9)7(14-4)11-10-5;1-11(9,10)3-2-4(6)5(7)8/h6-8H,1-5H3;9H2,1-4H3;4H,2-3,6H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | MYXUFXJACZOGFU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 231.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.65 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|