C14H16N4O6 — CID 70138915
2-[2-(6-ethyl-7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethylamino]acetic acid (PubChem CID 70138915) has the molecular formula C14H16N4O6 and a molecular weight of 336.30 g/mol. Its IUPAC name is 2-[2-(6-ethyl-7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethylamino]acetic acid.
| Compound Name | 2-[2-(6-ethyl-7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethylamino]acetic acid |
|---|---|
| PubChem CID | 70138915 |
| Molecular Formula | C14H16N4O6 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[2-(6-ethyl-7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethylamino]acetic acid |
| SMILES | CCc1c([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c2c1CCNCC(=O)O |
| InChI | InChI=1S/C14H16N4O6/c1-2-7-8(3-4-15-6-11(19)20)12-9(5-10(7)18(23)24)16-13(21)14(22)17-12/h5,15H,2-4,6H2,1H3,(H,16,21)(H,17,22)(H,19,20) |
| InChIKey | PAKFKOZNKJUMOW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|