About 1-piperidin-4-ylhexa-2,5-dien-2-ol
1-piperidin-4-ylhexa-2,5-dien-2-ol (PubChem CID 70138953) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-piperidin-4-ylhexa-2,5-dien-2-ol.
Molecular Properties
| Compound Name | 1-piperidin-4-ylhexa-2,5-dien-2-ol |
| PubChem CID | 70138953 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-piperidin-4-ylhexa-2,5-dien-2-ol |
| SMILES | C=CCC=C(O)CC1CCNCC1 |
| InChI | InChI=1S/C11H19NO/c1-2-3-4-11(13)9-10-5-7-12-8-6-10/h2,4,10,12-13H,1,3,5-9H2 |
| InChIKey | LPNLSHAKNMLDFS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-piperidin-4-ylhexa-2,5-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-4-ylhexa-2,5-dien-2-ol?
The IUPAC name of 1-piperidin-4-ylhexa-2,5-dien-2-ol (CID 70138953) is 1-piperidin-4-ylhexa-2,5-dien-2-ol.
What is the SMILES notation for 1-piperidin-4-ylhexa-2,5-dien-2-ol?
The canonical SMILES for 1-piperidin-4-ylhexa-2,5-dien-2-ol is C=CCC=C(O)CC1CCNCC1.
What is the InChIKey of 1-piperidin-4-ylhexa-2,5-dien-2-ol?
The InChIKey is LPNLSHAKNMLDFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-2-3-4-11(13)9-10-5-7-12-8-6-10/h2,4,10,12-13H,1,3,5-9H2.
What are the key properties of 1-piperidin-4-ylhexa-2,5-dien-2-ol?
1-piperidin-4-ylhexa-2,5-dien-2-ol has a molecular weight of 181.28 g/mol, XLogP of 2.39, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-4-ylhexa-2,5-dien-2-ol is sourced from PubChem (CID 70138953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).