C12H18N2 — CID 70139056
(3aR,10aR)-1-methyl-3,3a,4,5,9,10-hexahydro-2H-pyrrolo[2,3-j]isoquinoline (PubChem CID 70139056) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (3aR,10aR)-1-methyl-3,3a,4,5,9,10-hexahydro-2H-pyrrolo[2,3-j]isoquinoline.
| Compound Name | (3aR,10aR)-1-methyl-3,3a,4,5,9,10-hexahydro-2H-pyrrolo[2,3-j]isoquinoline |
|---|---|
| PubChem CID | 70139056 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (3aR,10aR)-1-methyl-3,3a,4,5,9,10-hexahydro-2H-pyrrolo[2,3-j]isoquinoline |
| SMILES | CN1CC[C@H]2NCC=C3C=CCC[C@@]321 |
| InChI | InChI=1S/C12H18N2/c1-14-9-6-11-12(14)7-3-2-4-10(12)5-8-13-11/h2,4-5,11,13H,3,6-9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | HLFKNNJAUQCDHJ-VXGBXAGGSA-N |
| XLogP | 1.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |